aboutsummaryrefslogtreecommitdiff
path: root/lib
diff options
context:
space:
mode:
Diffstat (limited to 'lib')
-rw-r--r--lib/AST/ASTContext.cpp105
-rw-r--r--lib/AST/ASTImporter.cpp12
-rw-r--r--lib/AST/ExprCXX.cpp19
-rw-r--r--lib/AST/Type.cpp66
-rw-r--r--lib/CodeGen/CodeGenFunction.cpp11
-rw-r--r--lib/Rewrite/RewriteObjC.cpp111
-rw-r--r--lib/Sema/SemaDecl.cpp17
-rw-r--r--lib/Sema/SemaDeclCXX.cpp95
-rw-r--r--lib/Sema/SemaExceptionSpec.cpp35
-rw-r--r--lib/Sema/SemaExpr.cpp22
-rw-r--r--lib/Sema/SemaExprCXX.cpp24
-rw-r--r--lib/Sema/SemaLookup.cpp11
-rw-r--r--lib/Sema/SemaTemplateInstantiateDecl.cpp15
-rw-r--r--lib/Sema/SemaType.cpp49
-rw-r--r--lib/Serialization/ASTReader.cpp29
15 files changed, 323 insertions, 298 deletions
diff --git a/lib/AST/ASTContext.cpp b/lib/AST/ASTContext.cpp
index a6b0861f02..ecba4a136f 100644
--- a/lib/AST/ASTContext.cpp
+++ b/lib/AST/ASTContext.cpp
@@ -1141,7 +1141,7 @@ QualType ASTContext::getObjCGCQualType(QualType T,
}
static QualType getExtFunctionType(ASTContext& Context, QualType T,
- const FunctionType::ExtInfo &Info) {
+ const FunctionType::ExtInfo &Info) {
QualType ResultType;
if (const PointerType *Pointer = T->getAs<PointerType>()) {
QualType Pointee = Pointer->getPointeeType();
@@ -1183,11 +1183,15 @@ static QualType getExtFunctionType(ASTContext& Context, QualType T,
Info);
} else {
const FunctionProtoType *FPT = cast<FunctionProtoType>(F);
- FunctionProtoType::ExtProtoInfo EPI = FPT->getExtProtoInfo();
- EPI.ExtInfo = Info;
- ResultType = Context.getFunctionType(FPT->getResultType(),
- FPT->arg_type_begin(),
- FPT->getNumArgs(), EPI);
+ ResultType
+ = Context.getFunctionType(FPT->getResultType(), FPT->arg_type_begin(),
+ FPT->getNumArgs(), FPT->isVariadic(),
+ FPT->getTypeQuals(),
+ FPT->hasExceptionSpec(),
+ FPT->hasAnyExceptionSpec(),
+ FPT->getNumExceptions(),
+ FPT->exception_begin(),
+ Info);
}
} else
return T;
@@ -1197,17 +1201,20 @@ static QualType getExtFunctionType(ASTContext& Context, QualType T,
QualType ASTContext::getNoReturnType(QualType T, bool AddNoReturn) {
FunctionType::ExtInfo Info = getFunctionExtInfo(T);
- return getExtFunctionType(*this, T, Info.withNoReturn(AddNoReturn));
+ return getExtFunctionType(*this, T,
+ Info.withNoReturn(AddNoReturn));
}
QualType ASTContext::getCallConvType(QualType T, CallingConv CallConv) {
FunctionType::ExtInfo Info = getFunctionExtInfo(T);
- return getExtFunctionType(*this, T, Info.withCallingConv(CallConv));
+ return getExtFunctionType(*this, T,
+ Info.withCallingConv(CallConv));
}
QualType ASTContext::getRegParmType(QualType T, unsigned RegParm) {
FunctionType::ExtInfo Info = getFunctionExtInfo(T);
- return getExtFunctionType(*this, T, Info.withRegParm(RegParm));
+ return getExtFunctionType(*this, T,
+ Info.withRegParm(RegParm));
}
/// getComplexType - Return the uniqued reference to the type for a complex
@@ -1756,13 +1763,20 @@ QualType ASTContext::getFunctionNoProtoType(QualType ResultTy,
/// getFunctionType - Return a normal function type with a typed argument
/// list. isVariadic indicates whether the argument list includes '...'.
-QualType ASTContext::getFunctionType(QualType ResultTy,
- const QualType *ArgArray, unsigned NumArgs,
- const FunctionProtoType::ExtProtoInfo &EPI) {
+QualType ASTContext::getFunctionType(QualType ResultTy,const QualType *ArgArray,
+ unsigned NumArgs, bool isVariadic,
+ unsigned TypeQuals, bool hasExceptionSpec,
+ bool hasAnyExceptionSpec, unsigned NumExs,
+ const QualType *ExArray,
+ const FunctionType::ExtInfo &Info) {
+
+ const CallingConv CallConv= Info.getCC();
// Unique functions, to guarantee there is only one function of a particular
// structure.
llvm::FoldingSetNodeID ID;
- FunctionProtoType::Profile(ID, ResultTy, ArgArray, NumArgs, EPI);
+ FunctionProtoType::Profile(ID, ResultTy, ArgArray, NumArgs, isVariadic,
+ TypeQuals, hasExceptionSpec, hasAnyExceptionSpec,
+ NumExs, ExArray, Info);
void *InsertPos = 0;
if (FunctionProtoType *FTP =
@@ -1770,13 +1784,11 @@ QualType ASTContext::getFunctionType(QualType ResultTy,
return QualType(FTP, 0);
// Determine whether the type being created is already canonical or not.
- bool isCanonical = !EPI.HasExceptionSpec && ResultTy.isCanonical();
+ bool isCanonical = !hasExceptionSpec && ResultTy.isCanonical();
for (unsigned i = 0; i != NumArgs && isCanonical; ++i)
if (!ArgArray[i].isCanonicalAsParam())
isCanonical = false;
- const CallingConv CallConv = EPI.ExtInfo.getCC();
-
// If this type isn't canonical, get the canonical version of it.
// The exception spec is not part of the canonical type.
QualType Canonical;
@@ -1786,18 +1798,11 @@ QualType ASTContext::getFunctionType(QualType ResultTy,
for (unsigned i = 0; i != NumArgs; ++i)
CanonicalArgs.push_back(getCanonicalParamType(ArgArray[i]));
- FunctionProtoType::ExtProtoInfo CanonicalEPI = EPI;
- if (CanonicalEPI.HasExceptionSpec) {
- CanonicalEPI.HasExceptionSpec = false;
- CanonicalEPI.HasAnyExceptionSpec = false;
- CanonicalEPI.NumExceptions = 0;
- }
- CanonicalEPI.ExtInfo
- = CanonicalEPI.ExtInfo.withCallingConv(getCanonicalCallConv(CallConv));
-
Canonical = getFunctionType(getCanonicalType(ResultTy),
CanonicalArgs.data(), NumArgs,
- CanonicalEPI);
+ isVariadic, TypeQuals, false,
+ false, 0, 0,
+ Info.withCallingConv(getCanonicalCallConv(CallConv)));
// Get the new insert position for the node we care about.
FunctionProtoType *NewIP =
@@ -1808,11 +1813,13 @@ QualType ASTContext::getFunctionType(QualType ResultTy,
// FunctionProtoType objects are allocated with extra bytes after them
// for two variable size arrays (for parameter and exception types) at the
// end of them.
- size_t Size = sizeof(FunctionProtoType) +
- NumArgs * sizeof(QualType) +
- EPI.NumExceptions * sizeof(QualType);
- FunctionProtoType *FTP = (FunctionProtoType*) Allocate(Size, TypeAlignment);
- new (FTP) FunctionProtoType(ResultTy, ArgArray, NumArgs, Canonical, EPI);
+ FunctionProtoType *FTP =
+ (FunctionProtoType*)Allocate(sizeof(FunctionProtoType) +
+ NumArgs*sizeof(QualType) +
+ NumExs*sizeof(QualType), TypeAlignment);
+ new (FTP) FunctionProtoType(ResultTy, ArgArray, NumArgs, isVariadic,
+ TypeQuals, hasExceptionSpec, hasAnyExceptionSpec,
+ ExArray, NumExs, Canonical, Info);
Types.push_back(FTP);
FunctionProtoTypes.InsertNode(FTP, InsertPos);
return QualType(FTP, 0);
@@ -4845,8 +4852,6 @@ QualType ASTContext::mergeFunctionTypes(QualType lhs, QualType rhs,
if (!isSameCallConv(lcc, rcc))
return QualType();
- FunctionType::ExtInfo einfo = FunctionType::ExtInfo(NoReturn, RegParm, lcc);
-
if (lproto && rproto) { // two C99 style function prototypes
assert(!lproto->hasExceptionSpec() && !rproto->hasExceptionSpec() &&
"C++ shouldn't be here");
@@ -4890,10 +4895,10 @@ QualType ASTContext::mergeFunctionTypes(QualType lhs, QualType rhs,
}
if (allLTypes) return lhs;
if (allRTypes) return rhs;
-
- FunctionProtoType::ExtProtoInfo EPI = lproto->getExtProtoInfo();
- EPI.ExtInfo = einfo;
- return getFunctionType(retType, types.begin(), types.size(), EPI);
+ return getFunctionType(retType, types.begin(), types.size(),
+ lproto->isVariadic(), lproto->getTypeQuals(),
+ false, false, 0, 0,
+ FunctionType::ExtInfo(NoReturn, RegParm, lcc));
}
if (lproto) allRTypes = false;
@@ -4924,11 +4929,11 @@ QualType ASTContext::mergeFunctionTypes(QualType lhs, QualType rhs,
if (allLTypes) return lhs;
if (allRTypes) return rhs;
-
- FunctionProtoType::ExtProtoInfo EPI = proto->getExtProtoInfo();
- EPI.ExtInfo = einfo;
return getFunctionType(retType, proto->arg_type_begin(),
- proto->getNumArgs(), EPI);
+ proto->getNumArgs(), proto->isVariadic(),
+ proto->getTypeQuals(),
+ false, false, 0, 0,
+ FunctionType::ExtInfo(NoReturn, RegParm, lcc));
}
if (allLTypes) return lhs;
@@ -5213,11 +5218,16 @@ QualType ASTContext::mergeObjCGCQualifiers(QualType LHS, QualType RHS) {
// In either case, use OldReturnType to build the new function type.
const FunctionType *F = LHS->getAs<FunctionType>();
if (const FunctionProtoType *FPT = cast<FunctionProtoType>(F)) {
- FunctionProtoType::ExtProtoInfo EPI = FPT->getExtProtoInfo();
- EPI.ExtInfo = getFunctionExtInfo(LHS);
+ FunctionType::ExtInfo Info = getFunctionExtInfo(LHS);
QualType ResultType
= getFunctionType(OldReturnType, FPT->arg_type_begin(),
- FPT->getNumArgs(), EPI);
+ FPT->getNumArgs(), FPT->isVariadic(),
+ FPT->getTypeQuals(),
+ FPT->hasExceptionSpec(),
+ FPT->hasAnyExceptionSpec(),
+ FPT->getNumExceptions(),
+ FPT->exception_begin(),
+ Info);
return ResultType;
}
}
@@ -5570,11 +5580,10 @@ QualType ASTContext::GetBuiltinType(unsigned Id,
if (ArgTypes.size() == 0 && TypeStr[0] == '.')
return getFunctionNoProtoType(ResType);
- FunctionProtoType::ExtProtoInfo EPI;
- EPI.Variadic = (TypeStr[0] == '.');
// FIXME: Should we create noreturn types?
-
- return getFunctionType(ResType, ArgTypes.data(), ArgTypes.size(), EPI);
+ return getFunctionType(ResType, ArgTypes.data(), ArgTypes.size(),
+ TypeStr[0] == '.', 0, false, false, 0, 0,
+ FunctionType::ExtInfo());
}
GVALinkage ASTContext::GetGVALinkageForFunction(const FunctionDecl *FD) {
diff --git a/lib/AST/ASTImporter.cpp b/lib/AST/ASTImporter.cpp
index cc485c47d9..8415977349 100644
--- a/lib/AST/ASTImporter.cpp
+++ b/lib/AST/ASTImporter.cpp
@@ -1473,12 +1473,16 @@ QualType ASTNodeImporter::VisitFunctionProtoType(FunctionProtoType *T) {
return QualType();
ExceptionTypes.push_back(ExceptionType);
}
-
- FunctionProtoType::ExtProtoInfo EPI = T->getExtProtoInfo();
- EPI.Exceptions = ExceptionTypes.data();
return Importer.getToContext().getFunctionType(ToResultType, ArgTypes.data(),
- ArgTypes.size(), EPI);
+ ArgTypes.size(),
+ T->isVariadic(),
+ T->getTypeQuals(),
+ T->hasExceptionSpec(),
+ T->hasAnyExceptionSpec(),
+ ExceptionTypes.size(),
+ ExceptionTypes.data(),
+ T->getExtInfo());
}
QualType ASTNodeImporter::VisitTypedefType(TypedefType *T) {
diff --git a/lib/AST/ExprCXX.cpp b/lib/AST/ExprCXX.cpp
index 1c134608a5..b67e82453d 100644
--- a/lib/AST/ExprCXX.cpp
+++ b/lib/AST/ExprCXX.cpp
@@ -185,25 +185,6 @@ PseudoDestructorTypeStorage::PseudoDestructorTypeStorage(TypeSourceInfo *Info)
Location = Info->getTypeLoc().getLocalSourceRange().getBegin();
}
-CXXPseudoDestructorExpr::CXXPseudoDestructorExpr(ASTContext &Context,
- Expr *Base, bool isArrow, SourceLocation OperatorLoc,
- NestedNameSpecifier *Qualifier, SourceRange QualifierRange,
- TypeSourceInfo *ScopeType, SourceLocation ColonColonLoc,
- SourceLocation TildeLoc, PseudoDestructorTypeStorage DestroyedType)
- : Expr(CXXPseudoDestructorExprClass,
- Context.getPointerType(Context.getFunctionType(Context.VoidTy, 0, 0,
- FunctionProtoType::ExtProtoInfo())),
- VK_RValue, OK_Ordinary,
- /*isTypeDependent=*/(Base->isTypeDependent() ||
- (DestroyedType.getTypeSourceInfo() &&
- DestroyedType.getTypeSourceInfo()->getType()->isDependentType())),
- /*isValueDependent=*/Base->isValueDependent()),
- Base(static_cast<Stmt *>(Base)), IsArrow(isArrow),
- OperatorLoc(OperatorLoc), Qualifier(Qualifier),
- QualifierRange(QualifierRange),
- ScopeType(ScopeType), ColonColonLoc(ColonColonLoc), TildeLoc(TildeLoc),
- DestroyedType(DestroyedType) { }
-
QualType CXXPseudoDestructorExpr::getDestroyedType() const {
if (TypeSourceInfo *TInfo = DestroyedType.getTypeSourceInfo())
return TInfo->getType();
diff --git a/lib/AST/Type.cpp b/lib/AST/Type.cpp
index 25aa5e0ea1..127613ed32 100644
--- a/lib/AST/Type.cpp
+++ b/lib/AST/Type.cpp
@@ -1097,55 +1097,65 @@ llvm::StringRef FunctionType::getNameForCallConv(CallingConv CC) {
return "";
}
-FunctionProtoType::FunctionProtoType(QualType result, const QualType *args,
- unsigned numArgs, QualType canonical,
- const ExtProtoInfo &epi)
- : FunctionType(FunctionProto, result, epi.Variadic, epi.TypeQuals, canonical,
- result->isDependentType(),
- result->isVariablyModifiedType(),
- result->containsUnexpandedParameterPack(),
- epi.ExtInfo),
- NumArgs(numArgs), NumExceptions(epi.NumExceptions),
- HasExceptionSpec(epi.HasExceptionSpec),
- HasAnyExceptionSpec(epi.HasAnyExceptionSpec)
+FunctionProtoType::FunctionProtoType(QualType Result, const QualType *ArgArray,
+ unsigned numArgs, bool isVariadic,
+ unsigned typeQuals, bool hasExs,
+ bool hasAnyExs, const QualType *ExArray,
+ unsigned numExs, QualType Canonical,
+ const ExtInfo &Info)
+ : FunctionType(FunctionProto, Result, isVariadic, typeQuals, Canonical,
+ Result->isDependentType(),
+ Result->isVariablyModifiedType(),
+ Result->containsUnexpandedParameterPack(),
+ Info),
+ NumArgs(numArgs), NumExceptions(numExs), HasExceptionSpec(hasExs),
+ AnyExceptionSpec(hasAnyExs)
{
// Fill in the trailing argument array.
- QualType *argSlot = reinterpret_cast<QualType*>(this+1);
+ QualType *ArgInfo = reinterpret_cast<QualType*>(this+1);
for (unsigned i = 0; i != numArgs; ++i) {
- if (args[i]->isDependentType())
+ if (ArgArray[i]->isDependentType())
setDependent();
- if (args[i]->containsUnexpandedParameterPack())
+ if (ArgArray[i]->containsUnexpandedParameterPack())
setContainsUnexpandedParameterPack();
- argSlot[i] = args[i];
+ ArgInfo[i] = ArgArray[i];
}
// Fill in the exception array.
- QualType *exnSlot = argSlot + numArgs;
- for (unsigned i = 0, e = epi.NumExceptions; i != e; ++i)
- exnSlot[i] = epi.Exceptions[i];
+ QualType *Ex = ArgInfo + numArgs;
+ for (unsigned i = 0; i != numExs; ++i)
+ Ex[i] = ExArray[i];
}
void FunctionProtoType::Profile(llvm::FoldingSetNodeID &ID, QualType Result,
- const QualType *ArgTys, unsigned NumArgs,
- const ExtProtoInfo &epi) {
+ arg_type_iterator ArgTys,
+ unsigned NumArgs, bool isVariadic,
+ unsigned TypeQuals, bool hasExceptionSpec,
+ bool anyExceptionSpec, unsigned NumExceptions,
+ exception_iterator Exs,
+ FunctionType::ExtInfo Info) {
ID.AddPointer(Result.getAsOpaquePtr());
for (unsigned i = 0; i != NumArgs; ++i)
ID.AddPointer(ArgTys[i].getAsOpaquePtr());
- ID.AddBoolean(epi.Variadic);
- ID.AddInteger(epi.TypeQuals);
- if (epi.HasExceptionSpec) {
- ID.AddBoolean(epi.HasAnyExceptionSpec);
- for (unsigned i = 0; i != epi.NumExceptions; ++i)
- ID.AddPointer(epi.Exceptions[i].getAsOpaquePtr());
+ ID.AddInteger(isVariadic);
+ ID.AddInteger(TypeQuals);
+ ID.AddInteger(hasExceptionSpec);
+ if (hasExceptionSpec) {
+ ID.AddInteger(anyExceptionSpec);
+ for (unsigned i = 0; i != NumExceptions; ++i)
+ ID.AddPointer(Exs[i].getAsOpaquePtr());
}
- epi.ExtInfo.Profile(ID);
+ Info.Profile(ID);
}
void FunctionProtoType::Profile(llvm::FoldingSetNodeID &ID) {
- Profile(ID, getResultType(), arg_type_begin(), NumArgs, getExtProtoInfo());
+ Profile(ID, getResultType(), arg_type_begin(), NumArgs, isVariadic(),
+ getTypeQuals(), hasExceptionSpec(), hasAnyExceptionSpec(),
+ getNumExceptions(), exception_begin(),
+ getExtInfo());
}
QualType TypedefType::desugar() const {
diff --git a/lib/CodeGen/CodeGenFunction.cpp b/lib/CodeGen/CodeGenFunction.cpp
index 8a0d78cc21..7bd0c3da9e 100644
--- a/lib/CodeGen/CodeGenFunction.cpp
+++ b/lib/CodeGen/CodeGenFunction.cpp
@@ -250,14 +250,13 @@ void CodeGenFunction::StartFunction(GlobalDecl GD, QualType RetTy,
Builder.SetInsertPoint(EntryBB);
+ QualType FnType = getContext().getFunctionType(RetTy, 0, 0, false, 0,
+ false, false, 0, 0,
+ /*FIXME?*/
+ FunctionType::ExtInfo());
+
// Emit subprogram debug descriptor.
if (CGDebugInfo *DI = getDebugInfo()) {
- // FIXME: what is going on here and why does it ignore all these
- // interesting type properties?
- QualType FnType =
- getContext().getFunctionType(RetTy, 0, 0,
- FunctionProtoType::ExtProtoInfo());
-
DI->setLocation(StartLoc);
DI->EmitFunctionStart(GD, FnType, CurFn, Builder);
}
diff --git a/lib/Rewrite/RewriteObjC.cpp b/lib/Rewrite/RewriteObjC.cpp
index 539ee49a6c..0d3881197b 100644
--- a/lib/Rewrite/RewriteObjC.cpp
+++ b/lib/Rewrite/RewriteObjC.cpp
@@ -450,15 +450,6 @@ namespace {
To += From[i];
}
}
-
- QualType getSimpleFunctionType(QualType result,
- const QualType *args,
- unsigned numArgs,
- bool variadic = false) {
- FunctionProtoType::ExtProtoInfo fpi;
- fpi.Variadic = variadic;
- return Context->getFunctionType(result, args, numArgs, fpi);
- }
};
// Helper function: create a CStyleCastExpr with trivial type source info.
@@ -2361,8 +2352,11 @@ void RewriteObjC::SynthSelGetUidFunctionDecl() {
IdentifierInfo *SelGetUidIdent = &Context->Idents.get("sel_registerName");
llvm::SmallVector<QualType, 16> ArgTys;
ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
- QualType getFuncType =
- getSimpleFunctionType(Context->getObjCSelType(), &ArgTys[0], ArgTys.size());
+ QualType getFuncType = Context->getFunctionType(Context->getObjCSelType(),
+ &ArgTys[0], ArgTys.size(),
+ false /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
SelGetUidFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
SelGetUidIdent, getFuncType, 0,
@@ -2457,8 +2451,11 @@ void RewriteObjC::SynthSuperContructorFunctionDecl() {
assert(!argT.isNull() && "Can't find 'id' type");
ArgTys.push_back(argT);
ArgTys.push_back(argT);
- QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size());
+ QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ false, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
SuperContructorFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2476,9 +2473,11 @@ void RewriteObjC::SynthMsgSendFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/);
+ QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
MsgSendFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2499,9 +2498,11 @@ void RewriteObjC::SynthMsgSendSuperFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/);
+ QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
MsgSendSuperFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2519,9 +2520,11 @@ void RewriteObjC::SynthMsgSendStretFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/);
+ QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
MsgSendStretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2544,9 +2547,11 @@ void RewriteObjC::SynthMsgSendSuperStretFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/);
+ QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
MsgSendSuperStretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2564,9 +2569,11 @@ void RewriteObjC::SynthMsgSendFpretFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = getSimpleFunctionType(Context->DoubleTy,
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/);
+ QualType msgSendType = Context->getFunctionType(Context->DoubleTy,
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
MsgSendFpretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2579,8 +2586,11 @@ void RewriteObjC::SynthGetClassFunctionDecl() {
IdentifierInfo *getClassIdent = &Context->Idents.get("objc_getClass");
llvm::SmallVector<QualType, 16> ArgTys;
ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
- QualType getClassType = getSimpleFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size());
+ QualType getClassType = Context->getFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ false /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
GetClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
getClassIdent, getClassType, 0,
@@ -2594,8 +2604,11 @@ void RewriteObjC::SynthGetSuperClassFunctionDecl() {
&Context->Idents.get("class_getSuperclass");
llvm::SmallVector<QualType, 16> ArgTys;
ArgTys.push_back(Context->getObjCClassType());
- QualType getClassType = getSimpleFunctionType(Context->getObjCClassType(),
- &ArgTys[0], ArgTys.size());
+ QualType getClassType = Context->getFunctionType(Context->getObjCClassType(),
+ &ArgTys[0], ArgTys.size(),
+ false /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
GetSuperClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
getSuperClassIdent,
@@ -2610,8 +2623,11 @@ void RewriteObjC::SynthGetMetaClassFunctionDecl() {
IdentifierInfo *getClassIdent = &Context->Idents.get("objc_getMetaClass");
llvm::SmallVector<QualType, 16> ArgTys;
ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
- QualType getClassType = getSimpleFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size());
+ QualType getClassType = Context->getFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ false /*isVariadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
GetMetaClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
getClassIdent, getClassType, 0,
@@ -3059,10 +3075,12 @@ Stmt *RewriteObjC::SynthMessageExpr(ObjCMessageExpr *Exp,
CK_BitCast, DRE);
// Now do the "normal" pointer to function cast.
- QualType castType =
- getSimpleFunctionType(returnType, &ArgTypes[0], ArgTypes.size(),
- // If we don't have a method decl, force a variadic cast.
- Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : true);
+ QualType castType = Context->getFunctionType(returnType,
+ &ArgTypes[0], ArgTypes.size(),
+ // If we don't have a method decl, force a variadic cast.
+ Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : true, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
castType = Context->getPointerType(castType);
cast = NoTypeInfoCStyleCastExpr(Context, castType, CK_BitCast,
cast);
@@ -3090,8 +3108,11 @@ Stmt *RewriteObjC::SynthMessageExpr(ObjCMessageExpr *Exp,
Context->getPointerType(Context->VoidTy),
CK_BitCast, STDRE);
// Now do the "normal" pointer to function cast.
- castType = getSimpleFunctionType(returnType, &ArgTypes[0], ArgTypes.size(),
- Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : false);
+ castType = Context->getFunctionType(returnType,
+ &ArgTypes[0], ArgTypes.size(),
+ Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : false, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
castType = Context->getPointerType(castType);
cast = NoTypeInfoCStyleCastExpr(Context, castType, CK_BitCast,
cast);
@@ -4628,7 +4649,9 @@ QualType RewriteObjC::convertFunctionTypeOfBlocks(const FunctionType *FT) {
// FIXME. Does this work if block takes no argument but has a return type
// which is of block type?
if (HasBlockType)
- FuncType = getSimpleFunctionType(Res, &ArgTypes[0], ArgTypes.size());
+ FuncType = Context->getFunctionType(Res,
+ &ArgTypes[0], ArgTypes.size(), false/*no variadic*/, 0,
+ false, false, 0, 0, FunctionType::ExtInfo());
else FuncType = QualType(FT, 0);
return FuncType;
}
@@ -4696,8 +4719,10 @@ Stmt *RewriteObjC::SynthesizeBlockCall(CallExpr *Exp, const Expr *BlockExp) {
}
}
// Now do the pointer to function cast.
- QualType PtrToFuncCastType
- = getSimpleFunctionType(Exp->getType(), &ArgTypes[0], ArgTypes.size());
+ QualType PtrToFuncCastType = Context->getFunctionType(Exp->getType(),
+ &ArgTypes[0], ArgTypes.size(), false/*no variadic*/, 0,
+ false, false, 0, 0,
+ FunctionType::ExtInfo());
PtrToFuncCastType = Context->getPointerType(PtrToFuncCastType);
diff --git a/lib/Sema/SemaDecl.cpp b/lib/Sema/SemaDecl.cpp
index 66e517008c..403838176c 100644
--- a/lib/Sema/SemaDecl.cpp
+++ b/lib/Sema/SemaDecl.cpp
@@ -1285,7 +1285,10 @@ bool Sema::MergeFunctionDecl(FunctionDecl *New, Decl *OldD) {
OldProto->arg_type_end());
NewQType = Context.getFunctionType(NewFuncType->getResultType(),
ParamTypes.data(), ParamTypes.size(),
- OldProto->getExtProtoInfo());
+ OldProto->isVariadic(),
+ OldProto->getTypeQuals(),
+ false, false, 0, 0,
+ OldProto->getExtInfo());
New->setType(NewQType);
New->setHasInheritedPrototype();
@@ -1367,7 +1370,9 @@ bool Sema::MergeFunctionDecl(FunctionDecl *New, Decl *OldD) {
New->setType(Context.getFunctionType(MergedReturn, &ArgTypes[0],
ArgTypes.size(),
- OldProto->getExtProtoInfo()));
+ OldProto->isVariadic(), 0,
+ false, false, 0, 0,
+ OldProto->getExtInfo()));
return MergeCompatibleFunctionDecls(New, Old);
}
@@ -4041,11 +4046,9 @@ Sema::ActOnFunctionDeclarator(Scope* S, Declarator& D, DeclContext* DC,
// Turn this into a variadic function with no parameters.
const FunctionType *FT = NewFD->getType()->getAs<FunctionType>();
- FunctionProtoType::ExtProtoInfo EPI;
- EPI.Variadic = true;
- EPI.ExtInfo = FT->getExtInfo();
-
- QualType R = Context.getFunctionType(FT->getResultType(), 0, 0, EPI);
+ QualType R = Context.getFunctionType(FT->getResultType(),
+ 0, 0, true, 0, false, false, 0, 0,
+ FT->getExtInfo());
NewFD->setType(R);
}
diff --git a/lib/Sema/SemaDeclCXX.cpp b/lib/Sema/SemaDeclCXX.cpp
index eec80f0d5a..3cfde26d24 100644
--- a/lib/Sema/SemaDeclCXX.cpp
+++ b/lib/Sema/SemaDeclCXX.cpp
@@ -2851,21 +2851,20 @@ QualType Sema::CheckConstructorDeclarator(Declarator &D, QualType R,
if (FTI.TypeQuals & Qualifiers::Restrict)
Diag(D.getIdentifierLoc(), diag::err_invalid_qualified_constructor)
<< "restrict" << SourceRange(D.getIdentifierLoc());
- D.setInvalidType();
}
// Rebuild the function type "R" without any type qualifiers (in
// case any of the errors above fired) and with "void" as the
// return type, since constructors don't have return types.
const FunctionProtoType *Proto = R->getAs<FunctionProtoType>();
- if (Proto->getResultType() == Context.VoidTy && !D.isInvalidType())
- return R;
-
- FunctionProtoType::ExtProtoInfo EPI = Proto->getExtProtoInfo();
- EPI.TypeQuals = 0;
-
return Context.getFunctionType(Context.VoidTy, Proto->arg_type_begin(),
- Proto->getNumArgs(), EPI);
+ Proto->getNumArgs(),
+ Proto->isVariadic(), 0,
+ Proto->hasExceptionSpec(),
+ Proto->hasAnyExceptionSpec(),
+ Proto->getNumExceptions(),
+ Proto->exception_begin(),
+ Proto->getExtInfo());
}
/// CheckConstructor - Checks a fully-formed constructor for
@@ -3023,14 +3022,16 @@ QualType Sema::CheckDestructorDeclarator(Declarator &D, QualType R,
// parameters (in case any of the errors above fired) and with
// "void" as the return type, since destructors don't have return
// types.
- if (!D.isInvalidType())
- return R;
-
const FunctionProtoType *Proto = R->getAs<FunctionProtoType>();
- FunctionProtoType::ExtProtoInfo EPI = Proto->getExtProtoInfo();
- EPI.Variadic = false;
- EPI.TypeQuals = 0;
- return Context.getFunctionType(Context.VoidTy, 0, 0, EPI);
+ if (!Proto)
+ return QualType();
+
+ return Context.getFunctionType(Context.VoidTy, 0, 0, false, 0,
+ Proto->hasExceptionSpec(),
+