aboutsummaryrefslogtreecommitdiff
path: root/lib
diff options
context:
space:
mode:
Diffstat (limited to 'lib')
-rw-r--r--lib/AST/ASTContext.cpp105
-rw-r--r--lib/AST/ASTImporter.cpp12
-rw-r--r--lib/AST/ExprCXX.cpp19
-rw-r--r--lib/AST/Type.cpp66
-rw-r--r--lib/CodeGen/CodeGenFunction.cpp11
-rw-r--r--lib/Rewrite/RewriteObjC.cpp111
-rw-r--r--lib/Sema/SemaDecl.cpp17
-rw-r--r--lib/Sema/SemaDeclCXX.cpp95
-rw-r--r--lib/Sema/SemaExceptionSpec.cpp35
-rw-r--r--lib/Sema/SemaExpr.cpp22
-rw-r--r--lib/Sema/SemaExprCXX.cpp24
-rw-r--r--lib/Sema/SemaLookup.cpp11
-rw-r--r--lib/Sema/SemaTemplateInstantiateDecl.cpp15
-rw-r--r--lib/Sema/SemaType.cpp49
-rw-r--r--lib/Serialization/ASTReader.cpp29
15 files changed, 298 insertions, 323 deletions
diff --git a/lib/AST/ASTContext.cpp b/lib/AST/ASTContext.cpp
index ecba4a136f..a6b0861f02 100644
--- a/lib/AST/ASTContext.cpp
+++ b/lib/AST/ASTContext.cpp
@@ -1141,7 +1141,7 @@ QualType ASTContext::getObjCGCQualType(QualType T,
}
static QualType getExtFunctionType(ASTContext& Context, QualType T,
- const FunctionType::ExtInfo &Info) {
+ const FunctionType::ExtInfo &Info) {
QualType ResultType;
if (const PointerType *Pointer = T->getAs<PointerType>()) {
QualType Pointee = Pointer->getPointeeType();
@@ -1183,15 +1183,11 @@ static QualType getExtFunctionType(ASTContext& Context, QualType T,
Info);
} else {
const FunctionProtoType *FPT = cast<FunctionProtoType>(F);
- ResultType
- = Context.getFunctionType(FPT->getResultType(), FPT->arg_type_begin(),
- FPT->getNumArgs(), FPT->isVariadic(),
- FPT->getTypeQuals(),
- FPT->hasExceptionSpec(),
- FPT->hasAnyExceptionSpec(),
- FPT->getNumExceptions(),
- FPT->exception_begin(),
- Info);
+ FunctionProtoType::ExtProtoInfo EPI = FPT->getExtProtoInfo();
+ EPI.ExtInfo = Info;
+ ResultType = Context.getFunctionType(FPT->getResultType(),
+ FPT->arg_type_begin(),
+ FPT->getNumArgs(), EPI);
}
} else
return T;
@@ -1201,20 +1197,17 @@ static QualType getExtFunctionType(ASTContext& Context, QualType T,
QualType ASTContext::getNoReturnType(QualType T, bool AddNoReturn) {
FunctionType::ExtInfo Info = getFunctionExtInfo(T);
- return getExtFunctionType(*this, T,
- Info.withNoReturn(AddNoReturn));
+ return getExtFunctionType(*this, T, Info.withNoReturn(AddNoReturn));
}
QualType ASTContext::getCallConvType(QualType T, CallingConv CallConv) {
FunctionType::ExtInfo Info = getFunctionExtInfo(T);
- return getExtFunctionType(*this, T,
- Info.withCallingConv(CallConv));
+ return getExtFunctionType(*this, T, Info.withCallingConv(CallConv));
}
QualType ASTContext::getRegParmType(QualType T, unsigned RegParm) {
FunctionType::ExtInfo Info = getFunctionExtInfo(T);
- return getExtFunctionType(*this, T,
- Info.withRegParm(RegParm));
+ return getExtFunctionType(*this, T, Info.withRegParm(RegParm));
}
/// getComplexType - Return the uniqued reference to the type for a complex
@@ -1763,20 +1756,13 @@ QualType ASTContext::getFunctionNoProtoType(QualType ResultTy,
/// getFunctionType - Return a normal function type with a typed argument
/// list. isVariadic indicates whether the argument list includes '...'.
-QualType ASTContext::getFunctionType(QualType ResultTy,const QualType *ArgArray,
- unsigned NumArgs, bool isVariadic,
- unsigned TypeQuals, bool hasExceptionSpec,
- bool hasAnyExceptionSpec, unsigned NumExs,
- const QualType *ExArray,
- const FunctionType::ExtInfo &Info) {
-
- const CallingConv CallConv= Info.getCC();
+QualType ASTContext::getFunctionType(QualType ResultTy,
+ const QualType *ArgArray, unsigned NumArgs,
+ const FunctionProtoType::ExtProtoInfo &EPI) {
// Unique functions, to guarantee there is only one function of a particular
// structure.
llvm::FoldingSetNodeID ID;
- FunctionProtoType::Profile(ID, ResultTy, ArgArray, NumArgs, isVariadic,
- TypeQuals, hasExceptionSpec, hasAnyExceptionSpec,
- NumExs, ExArray, Info);
+ FunctionProtoType::Profile(ID, ResultTy, ArgArray, NumArgs, EPI);
void *InsertPos = 0;
if (FunctionProtoType *FTP =
@@ -1784,11 +1770,13 @@ QualType ASTContext::getFunctionType(QualType ResultTy,const QualType *ArgArray,
return QualType(FTP, 0);
// Determine whether the type being created is already canonical or not.
- bool isCanonical = !hasExceptionSpec && ResultTy.isCanonical();
+ bool isCanonical = !EPI.HasExceptionSpec && ResultTy.isCanonical();
for (unsigned i = 0; i != NumArgs && isCanonical; ++i)
if (!ArgArray[i].isCanonicalAsParam())
isCanonical = false;
+ const CallingConv CallConv = EPI.ExtInfo.getCC();
+
// If this type isn't canonical, get the canonical version of it.
// The exception spec is not part of the canonical type.
QualType Canonical;
@@ -1798,11 +1786,18 @@ QualType ASTContext::getFunctionType(QualType ResultTy,const QualType *ArgArray,
for (unsigned i = 0; i != NumArgs; ++i)
CanonicalArgs.push_back(getCanonicalParamType(ArgArray[i]));
+ FunctionProtoType::ExtProtoInfo CanonicalEPI = EPI;
+ if (CanonicalEPI.HasExceptionSpec) {
+ CanonicalEPI.HasExceptionSpec = false;
+ CanonicalEPI.HasAnyExceptionSpec = false;
+ CanonicalEPI.NumExceptions = 0;
+ }
+ CanonicalEPI.ExtInfo
+ = CanonicalEPI.ExtInfo.withCallingConv(getCanonicalCallConv(CallConv));
+
Canonical = getFunctionType(getCanonicalType(ResultTy),
CanonicalArgs.data(), NumArgs,
- isVariadic, TypeQuals, false,
- false, 0, 0,
- Info.withCallingConv(getCanonicalCallConv(CallConv)));
+ CanonicalEPI);
// Get the new insert position for the node we care about.
FunctionProtoType *NewIP =
@@ -1813,13 +1808,11 @@ QualType ASTContext::getFunctionType(QualType ResultTy,const QualType *ArgArray,
// FunctionProtoType objects are allocated with extra bytes after them
// for two variable size arrays (for parameter and exception types) at the
// end of them.
- FunctionProtoType *FTP =
- (FunctionProtoType*)Allocate(sizeof(FunctionProtoType) +
- NumArgs*sizeof(QualType) +
- NumExs*sizeof(QualType), TypeAlignment);
- new (FTP) FunctionProtoType(ResultTy, ArgArray, NumArgs, isVariadic,
- TypeQuals, hasExceptionSpec, hasAnyExceptionSpec,
- ExArray, NumExs, Canonical, Info);
+ size_t Size = sizeof(FunctionProtoType) +
+ NumArgs * sizeof(QualType) +
+ EPI.NumExceptions * sizeof(QualType);
+ FunctionProtoType *FTP = (FunctionProtoType*) Allocate(Size, TypeAlignment);
+ new (FTP) FunctionProtoType(ResultTy, ArgArray, NumArgs, Canonical, EPI);
Types.push_back(FTP);
FunctionProtoTypes.InsertNode(FTP, InsertPos);
return QualType(FTP, 0);
@@ -4852,6 +4845,8 @@ QualType ASTContext::mergeFunctionTypes(QualType lhs, QualType rhs,
if (!isSameCallConv(lcc, rcc))
return QualType();
+ FunctionType::ExtInfo einfo = FunctionType::ExtInfo(NoReturn, RegParm, lcc);
+
if (lproto && rproto) { // two C99 style function prototypes
assert(!lproto->hasExceptionSpec() && !rproto->hasExceptionSpec() &&
"C++ shouldn't be here");
@@ -4895,10 +4890,10 @@ QualType ASTContext::mergeFunctionTypes(QualType lhs, QualType rhs,
}
if (allLTypes) return lhs;
if (allRTypes) return rhs;
- return getFunctionType(retType, types.begin(), types.size(),
- lproto->isVariadic(), lproto->getTypeQuals(),
- false, false, 0, 0,
- FunctionType::ExtInfo(NoReturn, RegParm, lcc));
+
+ FunctionProtoType::ExtProtoInfo EPI = lproto->getExtProtoInfo();
+ EPI.ExtInfo = einfo;
+ return getFunctionType(retType, types.begin(), types.size(), EPI);
}
if (lproto) allRTypes = false;
@@ -4929,11 +4924,11 @@ QualType ASTContext::mergeFunctionTypes(QualType lhs, QualType rhs,
if (allLTypes) return lhs;
if (allRTypes) return rhs;
+
+ FunctionProtoType::ExtProtoInfo EPI = proto->getExtProtoInfo();
+ EPI.ExtInfo = einfo;
return getFunctionType(retType, proto->arg_type_begin(),
- proto->getNumArgs(), proto->isVariadic(),
- proto->getTypeQuals(),
- false, false, 0, 0,
- FunctionType::ExtInfo(NoReturn, RegParm, lcc));
+ proto->getNumArgs(), EPI);
}
if (allLTypes) return lhs;
@@ -5218,16 +5213,11 @@ QualType ASTContext::mergeObjCGCQualifiers(QualType LHS, QualType RHS) {
// In either case, use OldReturnType to build the new function type.
const FunctionType *F = LHS->getAs<FunctionType>();
if (const FunctionProtoType *FPT = cast<FunctionProtoType>(F)) {
- FunctionType::ExtInfo Info = getFunctionExtInfo(LHS);
+ FunctionProtoType::ExtProtoInfo EPI = FPT->getExtProtoInfo();
+ EPI.ExtInfo = getFunctionExtInfo(LHS);
QualType ResultType
= getFunctionType(OldReturnType, FPT->arg_type_begin(),
- FPT->getNumArgs(), FPT->isVariadic(),
- FPT->getTypeQuals(),
- FPT->hasExceptionSpec(),
- FPT->hasAnyExceptionSpec(),
- FPT->getNumExceptions(),
- FPT->exception_begin(),
- Info);
+ FPT->getNumArgs(), EPI);
return ResultType;
}
}
@@ -5580,10 +5570,11 @@ QualType ASTContext::GetBuiltinType(unsigned Id,
if (ArgTypes.size() == 0 && TypeStr[0] == '.')
return getFunctionNoProtoType(ResType);
+ FunctionProtoType::ExtProtoInfo EPI;
+ EPI.Variadic = (TypeStr[0] == '.');
// FIXME: Should we create noreturn types?
- return getFunctionType(ResType, ArgTypes.data(), ArgTypes.size(),
- TypeStr[0] == '.', 0, false, false, 0, 0,
- FunctionType::ExtInfo());
+
+ return getFunctionType(ResType, ArgTypes.data(), ArgTypes.size(), EPI);
}
GVALinkage ASTContext::GetGVALinkageForFunction(const FunctionDecl *FD) {
diff --git a/lib/AST/ASTImporter.cpp b/lib/AST/ASTImporter.cpp
index 8415977349..cc485c47d9 100644
--- a/lib/AST/ASTImporter.cpp
+++ b/lib/AST/ASTImporter.cpp
@@ -1473,16 +1473,12 @@ QualType ASTNodeImporter::VisitFunctionProtoType(FunctionProtoType *T) {
return QualType();
ExceptionTypes.push_back(ExceptionType);
}
+
+ FunctionProtoType::ExtProtoInfo EPI = T->getExtProtoInfo();
+ EPI.Exceptions = ExceptionTypes.data();
return Importer.getToContext().getFunctionType(ToResultType, ArgTypes.data(),
- ArgTypes.size(),
- T->isVariadic(),
- T->getTypeQuals(),
- T->hasExceptionSpec(),
- T->hasAnyExceptionSpec(),
- ExceptionTypes.size(),
- ExceptionTypes.data(),
- T->getExtInfo());
+ ArgTypes.size(), EPI);
}
QualType ASTNodeImporter::VisitTypedefType(TypedefType *T) {
diff --git a/lib/AST/ExprCXX.cpp b/lib/AST/ExprCXX.cpp
index b67e82453d..1c134608a5 100644
--- a/lib/AST/ExprCXX.cpp
+++ b/lib/AST/ExprCXX.cpp
@@ -185,6 +185,25 @@ PseudoDestructorTypeStorage::PseudoDestructorTypeStorage(TypeSourceInfo *Info)
Location = Info->getTypeLoc().getLocalSourceRange().getBegin();
}
+CXXPseudoDestructorExpr::CXXPseudoDestructorExpr(ASTContext &Context,
+ Expr *Base, bool isArrow, SourceLocation OperatorLoc,
+ NestedNameSpecifier *Qualifier, SourceRange QualifierRange,
+ TypeSourceInfo *ScopeType, SourceLocation ColonColonLoc,
+ SourceLocation TildeLoc, PseudoDestructorTypeStorage DestroyedType)
+ : Expr(CXXPseudoDestructorExprClass,
+ Context.getPointerType(Context.getFunctionType(Context.VoidTy, 0, 0,
+ FunctionProtoType::ExtProtoInfo())),
+ VK_RValue, OK_Ordinary,
+ /*isTypeDependent=*/(Base->isTypeDependent() ||
+ (DestroyedType.getTypeSourceInfo() &&
+ DestroyedType.getTypeSourceInfo()->getType()->isDependentType())),
+ /*isValueDependent=*/Base->isValueDependent()),
+ Base(static_cast<Stmt *>(Base)), IsArrow(isArrow),
+ OperatorLoc(OperatorLoc), Qualifier(Qualifier),
+ QualifierRange(QualifierRange),
+ ScopeType(ScopeType), ColonColonLoc(ColonColonLoc), TildeLoc(TildeLoc),
+ DestroyedType(DestroyedType) { }
+
QualType CXXPseudoDestructorExpr::getDestroyedType() const {
if (TypeSourceInfo *TInfo = DestroyedType.getTypeSourceInfo())
return TInfo->getType();
diff --git a/lib/AST/Type.cpp b/lib/AST/Type.cpp
index 127613ed32..25aa5e0ea1 100644
--- a/lib/AST/Type.cpp
+++ b/lib/AST/Type.cpp
@@ -1097,65 +1097,55 @@ llvm::StringRef FunctionType::getNameForCallConv(CallingConv CC) {
return "";
}
-FunctionProtoType::FunctionProtoType(QualType Result, const QualType *ArgArray,
- unsigned numArgs, bool isVariadic,
- unsigned typeQuals, bool hasExs,
- bool hasAnyExs, const QualType *ExArray,
- unsigned numExs, QualType Canonical,
- const ExtInfo &Info)
- : FunctionType(FunctionProto, Result, isVariadic, typeQuals, Canonical,
- Result->isDependentType(),
- Result->isVariablyModifiedType(),
- Result->containsUnexpandedParameterPack(),
- Info),
- NumArgs(numArgs), NumExceptions(numExs), HasExceptionSpec(hasExs),
- AnyExceptionSpec(hasAnyExs)
+FunctionProtoType::FunctionProtoType(QualType result, const QualType *args,
+ unsigned numArgs, QualType canonical,
+ const ExtProtoInfo &epi)
+ : FunctionType(FunctionProto, result, epi.Variadic, epi.TypeQuals, canonical,
+ result->isDependentType(),
+ result->isVariablyModifiedType(),
+ result->containsUnexpandedParameterPack(),
+ epi.ExtInfo),
+ NumArgs(numArgs), NumExceptions(epi.NumExceptions),
+ HasExceptionSpec(epi.HasExceptionSpec),
+ HasAnyExceptionSpec(epi.HasAnyExceptionSpec)
{
// Fill in the trailing argument array.
- QualType *ArgInfo = reinterpret_cast<QualType*>(this+1);
+ QualType *argSlot = reinterpret_cast<QualType*>(this+1);
for (unsigned i = 0; i != numArgs; ++i) {
- if (ArgArray[i]->isDependentType())
+ if (args[i]->isDependentType())
setDependent();
- if (ArgArray[i]->containsUnexpandedParameterPack())
+ if (args[i]->containsUnexpandedParameterPack())
setContainsUnexpandedParameterPack();
- ArgInfo[i] = ArgArray[i];
+ argSlot[i] = args[i];
}
// Fill in the exception array.
- QualType *Ex = ArgInfo + numArgs;
- for (unsigned i = 0; i != numExs; ++i)
- Ex[i] = ExArray[i];
+ QualType *exnSlot = argSlot + numArgs;
+ for (unsigned i = 0, e = epi.NumExceptions; i != e; ++i)
+ exnSlot[i] = epi.Exceptions[i];
}
void FunctionProtoType::Profile(llvm::FoldingSetNodeID &ID, QualType Result,
- arg_type_iterator ArgTys,
- unsigned NumArgs, bool isVariadic,
- unsigned TypeQuals, bool hasExceptionSpec,
- bool anyExceptionSpec, unsigned NumExceptions,
- exception_iterator Exs,
- FunctionType::ExtInfo Info) {
+ const QualType *ArgTys, unsigned NumArgs,
+ const ExtProtoInfo &epi) {
ID.AddPointer(Result.getAsOpaquePtr());
for (unsigned i = 0; i != NumArgs; ++i)
ID.AddPointer(ArgTys[i].getAsOpaquePtr());
- ID.AddInteger(isVariadic);
- ID.AddInteger(TypeQuals);
- ID.AddInteger(hasExceptionSpec);
- if (hasExceptionSpec) {
- ID.AddInteger(anyExceptionSpec);
- for (unsigned i = 0; i != NumExceptions; ++i)
- ID.AddPointer(Exs[i].getAsOpaquePtr());
+ ID.AddBoolean(epi.Variadic);
+ ID.AddInteger(epi.TypeQuals);
+ if (epi.HasExceptionSpec) {
+ ID.AddBoolean(epi.HasAnyExceptionSpec);
+ for (unsigned i = 0; i != epi.NumExceptions; ++i)
+ ID.AddPointer(epi.Exceptions[i].getAsOpaquePtr());
}
- Info.Profile(ID);
+ epi.ExtInfo.Profile(ID);
}
void FunctionProtoType::Profile(llvm::FoldingSetNodeID &ID) {
- Profile(ID, getResultType(), arg_type_begin(), NumArgs, isVariadic(),
- getTypeQuals(), hasExceptionSpec(), hasAnyExceptionSpec(),
- getNumExceptions(), exception_begin(),
- getExtInfo());
+ Profile(ID, getResultType(), arg_type_begin(), NumArgs, getExtProtoInfo());
}
QualType TypedefType::desugar() const {
diff --git a/lib/CodeGen/CodeGenFunction.cpp b/lib/CodeGen/CodeGenFunction.cpp
index 7bd0c3da9e..8a0d78cc21 100644
--- a/lib/CodeGen/CodeGenFunction.cpp
+++ b/lib/CodeGen/CodeGenFunction.cpp
@@ -250,13 +250,14 @@ void CodeGenFunction::StartFunction(GlobalDecl GD, QualType RetTy,
Builder.SetInsertPoint(EntryBB);
- QualType FnType = getContext().getFunctionType(RetTy, 0, 0, false, 0,
- false, false, 0, 0,
- /*FIXME?*/
- FunctionType::ExtInfo());
-
// Emit subprogram debug descriptor.
if (CGDebugInfo *DI = getDebugInfo()) {
+ // FIXME: what is going on here and why does it ignore all these
+ // interesting type properties?
+ QualType FnType =
+ getContext().getFunctionType(RetTy, 0, 0,
+ FunctionProtoType::ExtProtoInfo());
+
DI->setLocation(StartLoc);
DI->EmitFunctionStart(GD, FnType, CurFn, Builder);
}
diff --git a/lib/Rewrite/RewriteObjC.cpp b/lib/Rewrite/RewriteObjC.cpp
index 0d3881197b..539ee49a6c 100644
--- a/lib/Rewrite/RewriteObjC.cpp
+++ b/lib/Rewrite/RewriteObjC.cpp
@@ -450,6 +450,15 @@ namespace {
To += From[i];
}
}
+
+ QualType getSimpleFunctionType(QualType result,
+ const QualType *args,
+ unsigned numArgs,
+ bool variadic = false) {
+ FunctionProtoType::ExtProtoInfo fpi;
+ fpi.Variadic = variadic;
+ return Context->getFunctionType(result, args, numArgs, fpi);
+ }
};
// Helper function: create a CStyleCastExpr with trivial type source info.
@@ -2352,11 +2361,8 @@ void RewriteObjC::SynthSelGetUidFunctionDecl() {
IdentifierInfo *SelGetUidIdent = &Context->Idents.get("sel_registerName");
llvm::SmallVector<QualType, 16> ArgTys;
ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
- QualType getFuncType = Context->getFunctionType(Context->getObjCSelType(),
- &ArgTys[0], ArgTys.size(),
- false /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType getFuncType =
+ getSimpleFunctionType(Context->getObjCSelType(), &ArgTys[0], ArgTys.size());
SelGetUidFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
SelGetUidIdent, getFuncType, 0,
@@ -2451,11 +2457,8 @@ void RewriteObjC::SynthSuperContructorFunctionDecl() {
assert(!argT.isNull() && "Can't find 'id' type");
ArgTys.push_back(argT);
ArgTys.push_back(argT);
- QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- false, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size());
SuperContructorFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2473,11 +2476,9 @@ void RewriteObjC::SynthMsgSendFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/);
MsgSendFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2498,11 +2499,9 @@ void RewriteObjC::SynthMsgSendSuperFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/);
MsgSendSuperFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2520,11 +2519,9 @@ void RewriteObjC::SynthMsgSendStretFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/);
MsgSendStretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2547,11 +2544,9 @@ void RewriteObjC::SynthMsgSendSuperStretFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/);
MsgSendSuperStretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2569,11 +2564,9 @@ void RewriteObjC::SynthMsgSendFpretFunctionDecl() {
argT = Context->getObjCSelType();
assert(!argT.isNull() && "Can't find 'SEL' type");
ArgTys.push_back(argT);
- QualType msgSendType = Context->getFunctionType(Context->DoubleTy,
- &ArgTys[0], ArgTys.size(),
- true /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType msgSendType = getSimpleFunctionType(Context->DoubleTy,
+ &ArgTys[0], ArgTys.size(),
+ true /*isVariadic*/);
MsgSendFpretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
msgSendIdent, msgSendType, 0,
@@ -2586,11 +2579,8 @@ void RewriteObjC::SynthGetClassFunctionDecl() {
IdentifierInfo *getClassIdent = &Context->Idents.get("objc_getClass");
llvm::SmallVector<QualType, 16> ArgTys;
ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
- QualType getClassType = Context->getFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- false /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType getClassType = getSimpleFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size());
GetClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
getClassIdent, getClassType, 0,
@@ -2604,11 +2594,8 @@ void RewriteObjC::SynthGetSuperClassFunctionDecl() {
&Context->Idents.get("class_getSuperclass");
llvm::SmallVector<QualType, 16> ArgTys;
ArgTys.push_back(Context->getObjCClassType());
- QualType getClassType = Context->getFunctionType(Context->getObjCClassType(),
- &ArgTys[0], ArgTys.size(),
- false /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType getClassType = getSimpleFunctionType(Context->getObjCClassType(),
+ &ArgTys[0], ArgTys.size());
GetSuperClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
getSuperClassIdent,
@@ -2623,11 +2610,8 @@ void RewriteObjC::SynthGetMetaClassFunctionDecl() {
IdentifierInfo *getClassIdent = &Context->Idents.get("objc_getMetaClass");
llvm::SmallVector<QualType, 16> ArgTys;
ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
- QualType getClassType = Context->getFunctionType(Context->getObjCIdType(),
- &ArgTys[0], ArgTys.size(),
- false /*isVariadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType getClassType = getSimpleFunctionType(Context->getObjCIdType(),
+ &ArgTys[0], ArgTys.size());
GetMetaClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
SourceLocation(),
getClassIdent, getClassType, 0,
@@ -3075,12 +3059,10 @@ Stmt *RewriteObjC::SynthMessageExpr(ObjCMessageExpr *Exp,
CK_BitCast, DRE);
// Now do the "normal" pointer to function cast.
- QualType castType = Context->getFunctionType(returnType,
- &ArgTypes[0], ArgTypes.size(),
- // If we don't have a method decl, force a variadic cast.
- Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : true, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType castType =
+ getSimpleFunctionType(returnType, &ArgTypes[0], ArgTypes.size(),
+ // If we don't have a method decl, force a variadic cast.
+ Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : true);
castType = Context->getPointerType(castType);
cast = NoTypeInfoCStyleCastExpr(Context, castType, CK_BitCast,
cast);
@@ -3108,11 +3090,8 @@ Stmt *RewriteObjC::SynthMessageExpr(ObjCMessageExpr *Exp,
Context->getPointerType(Context->VoidTy),
CK_BitCast, STDRE);
// Now do the "normal" pointer to function cast.
- castType = Context->getFunctionType(returnType,
- &ArgTypes[0], ArgTypes.size(),
- Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : false, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ castType = getSimpleFunctionType(returnType, &ArgTypes[0], ArgTypes.size(),
+ Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : false);
castType = Context->getPointerType(castType);
cast = NoTypeInfoCStyleCastExpr(Context, castType, CK_BitCast,
cast);
@@ -4649,9 +4628,7 @@ QualType RewriteObjC::convertFunctionTypeOfBlocks(const FunctionType *FT) {
// FIXME. Does this work if block takes no argument but has a return type
// which is of block type?
if (HasBlockType)
- FuncType = Context->getFunctionType(Res,
- &ArgTypes[0], ArgTypes.size(), false/*no variadic*/, 0,
- false, false, 0, 0, FunctionType::ExtInfo());
+ FuncType = getSimpleFunctionType(Res, &ArgTypes[0], ArgTypes.size());
else FuncType = QualType(FT, 0);
return FuncType;
}
@@ -4719,10 +4696,8 @@ Stmt *RewriteObjC::SynthesizeBlockCall(CallExpr *Exp, const Expr *BlockExp) {
}
}
// Now do the pointer to function cast.
- QualType PtrToFuncCastType = Context->getFunctionType(Exp->getType(),
- &ArgTypes[0], ArgTypes.size(), false/*no variadic*/, 0,
- false, false, 0, 0,
- FunctionType::ExtInfo());
+ QualType PtrToFuncCastType
+ = getSimpleFunctionType(Exp->getType(), &ArgTypes[0], ArgTypes.size());
PtrToFuncCastType = Context->getPointerType(PtrToFuncCastType);
diff --git a/lib/Sema/SemaDecl.cpp b/lib/Sema/SemaDecl.cpp
index 403838176c..66e517008c 100644
--- a/lib/Sema/SemaDecl.cpp
+++ b/lib/Sema/SemaDecl.cpp
@@ -1285,10 +1285,7 @@ bool Sema::MergeFunctionDecl(FunctionDecl *New, Decl *OldD) {
OldProto->arg_type_end());
NewQType = Context.getFunctionType(NewFuncType->getResultType(),
ParamTypes.data(), ParamTypes.size(),
- OldProto->isVariadic(),
- OldProto->getTypeQuals(),
- false, false, 0, 0,
- OldProto->getExtInfo());
+ OldProto->getExtProtoInfo());
New->setType(NewQType);
New->setHasInheritedPrototype();
@@ -1370,9 +1367,7 @@ bool Sema::MergeFunctionDecl(FunctionDecl *New, Decl *OldD) {
New->setType(Context.getFunctionType(MergedReturn, &ArgTypes[0],
ArgTypes.size(),
- OldProto->isVariadic(), 0,
- false, false, 0, 0,
- OldProto->getExtInfo()));
+ OldProto->getExtProtoInfo()));
return MergeCompatibleFunctionDecls(New, Old);
}
@@ -4046,9 +4041,11 @@ Sema::ActOnFunctionDeclarator(Scope* S, Declarator& D, DeclContext* DC,
// Turn this into a variadic function with no parameters.
const FunctionType *FT = NewFD->getType()->getAs<FunctionType>();
- QualType R = Context.getFunctionType(FT->getResultType(),
- 0, 0, true, 0, false, false, 0, 0,
- FT->getExtInfo());
+ FunctionProtoType::ExtProtoInfo EPI;
+ EPI.Variadic = true;
+ EPI.ExtInfo = FT->getExtInfo();
+
+ QualType R = Context.getFunctionType(FT->getResultType(), 0, 0, EPI);
NewFD->setType(R);
}
diff --git a/lib/Sema/SemaDeclCXX.cpp b/lib/Sema/SemaDeclCXX.cpp
index 3cfde26d24..eec80f0d5a 100644
--- a/lib/Sema/SemaDeclCXX.cpp
+++ b/lib/Sema/SemaDeclCXX.cpp
@@ -2851,20 +2851,21 @@ QualType Sema::CheckConstructorDeclarator(Declarator &D, QualType R,
if (FTI.TypeQuals & Qualifiers::Restrict)
Diag(D.getIdentifierLoc(), diag::err_invalid_qualified_constructor)
<< "restrict" << SourceRange(D.getIdentifierLoc());
+ D.setInvalidType();
}
// Rebuild the function type "R" without any type qualifiers (in
// case any of the errors above fired) and with "void" as the
// return type, since constructors don't have return types.
const FunctionProtoType *Proto = R->getAs<FunctionProtoType>();
+ if (Proto->getResultType() == Context.VoidTy && !D.isInvalidType())
+ return R;
+
+ FunctionProtoType::ExtProtoInfo EPI = Proto->getExtProtoInfo();
+ EPI.TypeQuals = 0;
+
return Context.getFunctionType(Context.VoidTy, Proto->arg_type_begin(),
- Proto->getNumArgs(),
- Proto->isVariadic(), 0,
- Proto->hasExceptionSpec(),
- Proto->hasAnyExceptionSpec(),
- Proto->getNumExceptions(),
- Proto->exception_begin(),
- Proto->getExtInfo());
+ Proto->getNumArgs(), EPI);
}
/// CheckConstructor - Checks a fully-formed constructor for
@@ -3022,16 +3023,14 @@ QualType Sema::CheckDestructorDeclarator(Declarator &D, QualType R,
// parameters (in case any of the errors above fired) and with
// "void" as the return type, since destructors don't have return
// types.
+ if (!D.isInvalidType())
+ return R;
+
const FunctionProtoType *Proto = R->getAs<FunctionProtoType>();
- if (!Proto)
- return QualType();
-
- return Context.getFunctionType(Context.VoidTy, 0, 0, false, 0,
- Proto->hasExceptionSpec(),
- Proto->hasAnyExceptionSpec(),
- Proto->getNumExceptions(),
-